C33H26Cl2F4N4O4 — CID 87082568
1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine (PubChem CID 87082568) has the molecular formula C33H26Cl2F4N4O4 and a molecular weight of 689.49 g/mol. Its IUPAC name is 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine.
| Compound Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine |
|---|---|
| PubChem CID | 87082568 |
| Molecular Formula | C33H26Cl2F4N4O4 |
| Molecular Weight | 689.49 g/mol |
| Exact Mass | 688.13 |
| IUPAC Name | 1-[4-[(2R,5R)-2,5-bis(4-chloro-2-fluoro-5-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-phenylpiperidine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3cc([N+](=O)[O-])c(Cl)cc3F)N2c2cc(F)c(N3CCC(c4ccccc4)CC3)c(F)c2)c(F)cc1Cl |
| InChI | InChI=1S/C33H26Cl2F4N4O4/c34-23-16-25(36)21(14-31(23)42(44)45)29-6-7-30(22-15-32(43(46)47)24(35)17-26(22)37)41(29)20-12-27(38)33(28(39)13-20)40-10-8-19(9-11-40)18-4-2-1-3-5-18/h1-5,12-17,19,29-30H,6-11H2/t29-,30-/m1/s1 |
| InChIKey | BSSCCCDGFWWZEH-LOYHVIPDSA-N |
| XLogP | 9.83 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.49 |
| LogP ≤ 5 | 9.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|