C29H26Cl2F2N4O4 — CID 123508131
6-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-6-azaspiro[2.5]octane (PubChem CID 123508131) has the molecular formula C29H26Cl2F2N4O4 and a molecular weight of 603.45 g/mol. Its IUPAC name is 6-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-6-azaspiro[2.5]octane.
| Compound Name | 6-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-6-azaspiro[2.5]octane |
|---|---|
| PubChem CID | 123508131 |
| Molecular Formula | C29H26Cl2F2N4O4 |
| Molecular Weight | 603.45 g/mol |
| Exact Mass | 602.13 |
| IUPAC Name | 6-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-6-azaspiro[2.5]octane |
| SMILES | O=[N+]([O-])c1cc(C2CCC(c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cc(F)c(N3CCC4(CC3)CC4)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C29H26Cl2F2N4O4/c30-20-3-1-17(13-26(20)36(38)39)24-5-6-25(18-2-4-21(31)27(14-18)37(40)41)35(24)19-15-22(32)28(23(33)16-19)34-11-9-29(7-8-29)10-12-34/h1-4,13-16,24-25H,5-12H2 |
| InChIKey | RYAJVAMCRWGSCR-UHFFFAOYSA-N |
| XLogP | 8.55 |
| TPSA | 92.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.45 |
| LogP ≤ 5 | 8.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|