C34H30Cl2F2N4O5 — CID 123790861
1-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-(4-methoxyphenyl)piperidine (PubChem CID 123790861) has the molecular formula C34H30Cl2F2N4O5 and a molecular weight of 683.54 g/mol. Its IUPAC name is 1-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-(4-methoxyphenyl)piperidine.
| Compound Name | 1-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-(4-methoxyphenyl)piperidine |
|---|---|
| PubChem CID | 123790861 |
| Molecular Formula | C34H30Cl2F2N4O5 |
| Molecular Weight | 683.54 g/mol |
| Exact Mass | 682.16 |
| IUPAC Name | 1-[4-[2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-4-(4-methoxyphenyl)piperidine |
| SMILES | COc1ccc(C2CCN(c3c(F)cc(N4C(c5ccc(Cl)c([N+](=O)[O-])c5)CCC4c4ccc(Cl)c([N+](=O)[O-])c4)cc3F)CC2)cc1 |
| InChI | InChI=1S/C34H30Cl2F2N4O5/c1-47-25-6-2-20(3-7-25)21-12-14-39(15-13-21)34-28(37)18-24(19-29(34)38)40-30(22-4-8-26(35)32(16-22)41(43)44)10-11-31(40)23-5-9-27(36)33(17-23)42(45)46/h2-9,16-19,21,30-31H,10-15H2,1H3 |
| InChIKey | CALYAJSNYCVDFZ-UHFFFAOYSA-N |
| XLogP | 9.56 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.54 |
| LogP ≤ 5 | 9.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|