C32H26Cl2F2N4O5 — CID 87083025
4-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-2-phenylmorpholine (PubChem CID 87083025) has the molecular formula C32H26Cl2F2N4O5 and a molecular weight of 655.49 g/mol. Its IUPAC name is 4-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-2-phenylmorpholine.
| Compound Name | 4-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-2-phenylmorpholine |
|---|---|
| PubChem CID | 87083025 |
| Molecular Formula | C32H26Cl2F2N4O5 |
| Molecular Weight | 655.49 g/mol |
| Exact Mass | 654.12 |
| IUPAC Name | 4-[4-[(2R,5R)-2,5-bis(4-chloro-3-nitrophenyl)pyrrolidin-1-yl]-2,6-difluorophenyl]-2-phenylmorpholine |
| SMILES | O=[N+]([O-])c1cc([C@H]2CC[C@H](c3ccc(Cl)c([N+](=O)[O-])c3)N2c2cc(F)c(N3CCOC(c4ccccc4)C3)c(F)c2)ccc1Cl |
| InChI | InChI=1S/C32H26Cl2F2N4O5/c33-23-8-6-20(14-29(23)39(41)42)27-10-11-28(21-7-9-24(34)30(15-21)40(43)44)38(27)22-16-25(35)32(26(36)17-22)37-12-13-45-31(18-37)19-4-2-1-3-5-19/h1-9,14-17,27-28,31H,10-13,18H2/t27-,28-,31?/m1/s1 |
| InChIKey | FLFQKDFYRKOFLT-GSHKWTBTSA-N |
| XLogP | 8.75 |
| TPSA | 101.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.49 |
| LogP ≤ 5 | 8.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|