C17H14F3N3O5 — CID 97015229
(2R)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-phenylmorpholine (PubChem CID 97015229) has the molecular formula C17H14F3N3O5 and a molecular weight of 397.31 g/mol. Its IUPAC name is (2R)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-phenylmorpholine.
| Compound Name | (2R)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-phenylmorpholine |
|---|---|
| PubChem CID | 97015229 |
| Molecular Formula | C17H14F3N3O5 |
| Molecular Weight | 397.31 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | (2R)-4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-phenylmorpholine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCO[C@H](c2ccccc2)C1 |
| InChI | InChI=1S/C17H14F3N3O5/c18-17(19,20)12-8-13(22(24)25)16(14(9-12)23(26)27)21-6-7-28-15(10-21)11-4-2-1-3-5-11/h1-5,8-9,15H,6-7,10H2/t15-/m0/s1 |
| InChIKey | DEXMFGHBZDOWEV-HNNXBMFYSA-N |
| XLogP | 4.10 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.31 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|