C15H12F3N3O5S — CID 133363538
4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-thiophen-2-ylmorpholine (PubChem CID 133363538) has the molecular formula C15H12F3N3O5S and a molecular weight of 403.34 g/mol. Its IUPAC name is 4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-thiophen-2-ylmorpholine.
| Compound Name | 4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363538 |
| Molecular Formula | C15H12F3N3O5S |
| Molecular Weight | 403.34 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | 4-[2,6-dinitro-4-(trifluoromethyl)phenyl]-2-thiophen-2-ylmorpholine |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)cc([N+](=O)[O-])c1N1CCOC(c2cccs2)C1 |
| InChI | InChI=1S/C15H12F3N3O5S/c16-15(17,18)9-6-10(20(22)23)14(11(7-9)21(24)25)19-3-4-26-12(8-19)13-2-1-5-27-13/h1-2,5-7,12H,3-4,8H2 |
| InChIKey | FAYAWADJEDQCPA-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.34 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|