C14H13N3O5S — CID 133363496
4-(2,4-dinitrophenyl)-2-thiophen-2-ylmorpholine (PubChem CID 133363496) has the molecular formula C14H13N3O5S and a molecular weight of 335.34 g/mol. Its IUPAC name is 4-(2,4-dinitrophenyl)-2-thiophen-2-ylmorpholine.
| Compound Name | 4-(2,4-dinitrophenyl)-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363496 |
| Molecular Formula | C14H13N3O5S |
| Molecular Weight | 335.34 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 4-(2,4-dinitrophenyl)-2-thiophen-2-ylmorpholine |
| SMILES | O=[N+]([O-])c1ccc(N2CCOC(c3cccs3)C2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H13N3O5S/c18-16(19)10-3-4-11(12(8-10)17(20)21)15-5-6-22-13(9-15)14-2-1-7-23-14/h1-4,7-8,13H,5-6,9H2 |
| InChIKey | RXBZXXQZGLTQPB-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.34 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|