C8H12N2OS — CID 82280994
2-thiophen-2-ylmorpholin-4-amine (PubChem CID 82280994) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-thiophen-2-ylmorpholin-4-amine.
| Compound Name | 2-thiophen-2-ylmorpholin-4-amine |
|---|---|
| PubChem CID | 82280994 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-thiophen-2-ylmorpholin-4-amine |
| SMILES | NN1CCOC(c2cccs2)C1 |
| InChI | InChI=1S/C8H12N2OS/c9-10-3-4-11-7(6-10)8-2-1-5-12-8/h1-2,5,7H,3-4,6,9H2 |
| InChIKey | LYRQJZZDMXXKTK-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|