C12H15N3OS2 — CID 133363593
4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-thiophen-2-ylmorpholine (PubChem CID 133363593) has the molecular formula C12H15N3OS2 and a molecular weight of 281.41 g/mol. Its IUPAC name is 4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-thiophen-2-ylmorpholine.
| Compound Name | 4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-thiophen-2-ylmorpholine |
|---|---|
| PubChem CID | 133363593 |
| Molecular Formula | C12H15N3OS2 |
| Molecular Weight | 281.41 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-(3-ethyl-1,2,4-thiadiazol-5-yl)-2-thiophen-2-ylmorpholine |
| SMILES | CCc1nsc(N2CCOC(c3cccs3)C2)n1 |
| InChI | InChI=1S/C12H15N3OS2/c1-2-11-13-12(18-14-11)15-5-6-16-9(8-15)10-4-3-7-17-10/h3-4,7,9H,2,5-6,8H2,1H3 |
| InChIKey | BUCGOPUHHLTWQA-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.41 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |