C11H17ClN2O2S — CID 119757306
2-(methylamino)-1-(2-thiophen-2-ylmorpholin-4-yl)ethanone;hydrochloride (PubChem CID 119757306) has the molecular formula C11H17ClN2O2S and a molecular weight of 276.79 g/mol. Its IUPAC name is 2-(methylamino)-1-(2-thiophen-2-ylmorpholin-4-yl)ethanone;hydrochloride.
| Compound Name | 2-(methylamino)-1-(2-thiophen-2-ylmorpholin-4-yl)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119757306 |
| Molecular Formula | C11H17ClN2O2S |
| Molecular Weight | 276.79 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | 2-(methylamino)-1-(2-thiophen-2-ylmorpholin-4-yl)ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCOC(c2cccs2)C1.Cl |
| InChI | InChI=1S/C11H16N2O2S.ClH/c1-12-7-11(14)13-4-5-15-9(8-13)10-3-2-6-16-10;/h2-3,6,9,12H,4-5,7-8H2,1H3;1H |
| InChIKey | YRFXFKUGMLFYML-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.79 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |