C16H22N2O4S — CID 122024352
4-[(2-thiophen-2-ylmorpholine-4-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 122024352) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is 4-[(2-thiophen-2-ylmorpholine-4-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 4-[(2-thiophen-2-ylmorpholine-4-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 122024352 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | 4-[(2-thiophen-2-ylmorpholine-4-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(O)C1CCC(NC(=O)N2CCOC(c3cccs3)C2)CC1 |
| InChI | InChI=1S/C16H22N2O4S/c19-15(20)11-3-5-12(6-4-11)17-16(21)18-7-8-22-13(10-18)14-2-1-9-23-14/h1-2,9,11-13H,3-8,10H2,(H,17,21)(H,19,20) |
| InChIKey | HRJAULCQUMFOTD-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |