C14H21ClN2O2S — CID 119757298
(3-aminocyclopentyl)-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride (PubChem CID 119757298) has the molecular formula C14H21ClN2O2S and a molecular weight of 316.85 g/mol. Its IUPAC name is (3-aminocyclopentyl)-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride.
| Compound Name | (3-aminocyclopentyl)-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119757298 |
| Molecular Formula | C14H21ClN2O2S |
| Molecular Weight | 316.85 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | (3-aminocyclopentyl)-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride |
| SMILES | Cl.NC1CCC(C(=O)N2CCOC(c3cccs3)C2)C1 |
| InChI | InChI=1S/C14H20N2O2S.ClH/c15-11-4-3-10(8-11)14(17)16-5-6-18-12(9-16)13-2-1-7-19-13;/h1-2,7,10-12H,3-6,8-9,15H2;1H |
| InChIKey | LRBZPZQKARXKAZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.85 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |