C13H19ClN2O3S — CID 119757292
morpholin-3-yl-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride (PubChem CID 119757292) has the molecular formula C13H19ClN2O3S and a molecular weight of 318.83 g/mol. Its IUPAC name is morpholin-3-yl-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride.
| Compound Name | morpholin-3-yl-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119757292 |
| Molecular Formula | C13H19ClN2O3S |
| Molecular Weight | 318.83 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | morpholin-3-yl-(2-thiophen-2-ylmorpholin-4-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1COCCN1)N1CCOC(c2cccs2)C1 |
| InChI | InChI=1S/C13H18N2O3S.ClH/c16-13(10-9-17-5-3-14-10)15-4-6-18-11(8-15)12-2-1-7-19-12;/h1-2,7,10-11,14H,3-6,8-9H2;1H |
| InChIKey | SALLZWIRTQMOST-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.83 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |