C14H23Cl2N3OS — CID 119894779
(3-aminocyclopentyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119894779) has the molecular formula C14H23Cl2N3OS and a molecular weight of 352.33 g/mol. Its IUPAC name is (3-aminocyclopentyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (3-aminocyclopentyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119894779 |
| Molecular Formula | C14H23Cl2N3OS |
| Molecular Weight | 352.33 g/mol |
| Exact Mass | 351.09 |
| IUPAC Name | (3-aminocyclopentyl)-(4-thiophen-2-ylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | Cl.Cl.NC1CCC(C(=O)N2CCN(c3cccs3)CC2)C1 |
| InChI | InChI=1S/C14H21N3OS.2ClH/c15-12-4-3-11(10-12)14(18)17-7-5-16(6-8-17)13-2-1-9-19-13;;/h1-2,9,11-12H,3-8,10,15H2;2*1H |
| InChIKey | VILIBYOAVFUIIA-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.33 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |