C13H16Cl3FN2O2 — CID 119777407
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(methylamino)ethanone;hydrochloride (PubChem CID 119777407) has the molecular formula C13H16Cl3FN2O2 and a molecular weight of 357.64 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(methylamino)ethanone;hydrochloride.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(methylamino)ethanone;hydrochloride |
|---|---|
| PubChem CID | 119777407 |
| Molecular Formula | C13H16Cl3FN2O2 |
| Molecular Weight | 357.64 g/mol |
| Exact Mass | 356.03 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-2-(methylamino)ethanone;hydrochloride |
| SMILES | CNCC(=O)N1CCOC(c2cc(F)c(Cl)cc2Cl)C1.Cl |
| InChI | InChI=1S/C13H15Cl2FN2O2.ClH/c1-17-6-13(19)18-2-3-20-12(7-18)8-4-11(16)10(15)5-9(8)14;/h4-5,12,17H,2-3,6-7H2,1H3;1H |
| InChIKey | IKXFNIDACAOJSY-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.64 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|