C12H15Cl3FNO2 — CID 141261156
2-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanol;hydrochloride (PubChem CID 141261156) has the molecular formula C12H15Cl3FNO2 and a molecular weight of 330.61 g/mol. Its IUPAC name is 2-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanol;hydrochloride.
| Compound Name | 2-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanol;hydrochloride |
|---|---|
| PubChem CID | 141261156 |
| Molecular Formula | C12H15Cl3FNO2 |
| Molecular Weight | 330.61 g/mol |
| Exact Mass | 329.02 |
| IUPAC Name | 2-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]ethanol;hydrochloride |
| SMILES | Cl.OCCN1CCOC(c2cc(F)c(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C12H14Cl2FNO2.ClH/c13-9-6-10(14)11(15)5-8(9)12-7-16(1-3-17)2-4-18-12;/h5-6,12,17H,1-4,7H2;1H |
| InChIKey | FLJZJHLOLISEKK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.61 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|