C22H27Cl3FNO3 — CID 138959756
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2,3,5-trimethylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138959756) has the molecular formula C22H27Cl3FNO3 and a molecular weight of 478.82 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2,3,5-trimethylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2,3,5-trimethylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959756 |
| Molecular Formula | C22H27Cl3FNO3 |
| Molecular Weight | 478.82 g/mol |
| Exact Mass | 477.10 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2,3,5-trimethylphenoxy)propan-2-ol;hydrochloride |
| SMILES | Cc1cc(C)c(C)c(OCC(O)CN2CCOC(c3cc(F)c(Cl)cc3Cl)C2)c1.Cl |
| InChI | InChI=1S/C22H26Cl2FNO3.ClH/c1-13-6-14(2)15(3)21(7-13)29-12-16(27)10-26-4-5-28-22(11-26)17-8-20(25)19(24)9-18(17)23;/h6-9,16,22,27H,4-5,10-12H2,1-3H3;1H |
| InChIKey | IMCRKJVHFCEGFG-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.82 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|