C23H29Cl3FNO3 — CID 138959772
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138959772) has the molecular formula C23H29Cl3FNO3 and a molecular weight of 492.85 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959772 |
| Molecular Formula | C23H29Cl3FNO3 |
| Molecular Weight | 492.85 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(3-methyl-4-propan-2-ylphenoxy)propan-2-ol;hydrochloride |
| SMILES | Cc1cc(OCC(O)CN2CCOC(c3cc(F)c(Cl)cc3Cl)C2)ccc1C(C)C.Cl |
| InChI | InChI=1S/C23H28Cl2FNO3.ClH/c1-14(2)18-5-4-17(8-15(18)3)30-13-16(28)11-27-6-7-29-23(12-27)19-9-22(26)21(25)10-20(19)24;/h4-5,8-10,14,16,23,28H,6-7,11-13H2,1-3H3;1H |
| InChIKey | YBZXXNRSDQHFST-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.85 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|