C20H23Cl3FNO3 — CID 138959744
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2-methylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138959744) has the molecular formula C20H23Cl3FNO3 and a molecular weight of 450.77 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2-methylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2-methylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959744 |
| Molecular Formula | C20H23Cl3FNO3 |
| Molecular Weight | 450.77 g/mol |
| Exact Mass | 449.07 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(2-methylphenoxy)propan-2-ol;hydrochloride |
| SMILES | Cc1ccccc1OCC(O)CN1CCOC(c2cc(F)c(Cl)cc2Cl)C1.Cl |
| InChI | InChI=1S/C20H22Cl2FNO3.ClH/c1-13-4-2-3-5-19(13)27-12-14(25)10-24-6-7-26-20(11-24)15-8-18(23)17(22)9-16(15)21;/h2-5,8-9,14,20,25H,6-7,10-12H2,1H3;1H |
| InChIKey | BFSGGLLFFWFYHZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.77 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|