C19H20Cl3FN2O5 — CID 138959814
1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride (PubChem CID 138959814) has the molecular formula C19H20Cl3FN2O5 and a molecular weight of 481.74 g/mol. Its IUPAC name is 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959814 |
| Molecular Formula | C19H20Cl3FN2O5 |
| Molecular Weight | 481.74 g/mol |
| Exact Mass | 480.04 |
| IUPAC Name | 1-[2-(2,4-dichloro-5-fluorophenyl)morpholin-4-yl]-3-(4-nitrophenoxy)propan-2-ol;hydrochloride |
| SMILES | Cl.O=[N+]([O-])c1ccc(OCC(O)CN2CCOC(c3cc(F)c(Cl)cc3Cl)C2)cc1 |
| InChI | InChI=1S/C19H19Cl2FN2O5.ClH/c20-16-8-17(21)18(22)7-15(16)19-10-23(5-6-28-19)9-13(25)11-29-14-3-1-12(2-4-14)24(26)27;/h1-4,7-8,13,19,25H,5-6,9-11H2;1H |
| InChIKey | AISSLWATLRWKKU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 85.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.74 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|