C19H23ClFNO3 — CID 138958982
1-[2-(3-fluorophenyl)morpholin-4-yl]-3-phenoxypropan-2-ol;hydrochloride (PubChem CID 138958982) has the molecular formula C19H23ClFNO3 and a molecular weight of 367.85 g/mol. Its IUPAC name is 1-[2-(3-fluorophenyl)morpholin-4-yl]-3-phenoxypropan-2-ol;hydrochloride.
| Compound Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-3-phenoxypropan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138958982 |
| Molecular Formula | C19H23ClFNO3 |
| Molecular Weight | 367.85 g/mol |
| Exact Mass | 367.14 |
| IUPAC Name | 1-[2-(3-fluorophenyl)morpholin-4-yl]-3-phenoxypropan-2-ol;hydrochloride |
| SMILES | Cl.OC(COc1ccccc1)CN1CCOC(c2cccc(F)c2)C1 |
| InChI | InChI=1S/C19H22FNO3.ClH/c20-16-6-4-5-15(11-16)19-13-21(9-10-23-19)12-17(22)14-24-18-7-2-1-3-8-18;/h1-8,11,17,19,22H,9-10,12-14H2;1H |
| InChIKey | JOWLXQXDHWLLNO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |