C26H27F2NO3 — CID 138959078
1-benzhydryloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol (PubChem CID 138959078) has the molecular formula C26H27F2NO3 and a molecular weight of 439.50 g/mol. Its IUPAC name is 1-benzhydryloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol.
| Compound Name | 1-benzhydryloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 138959078 |
| Molecular Formula | C26H27F2NO3 |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.20 |
| IUPAC Name | 1-benzhydryloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol |
| SMILES | OC(COC(c1ccccc1)c1ccccc1)CN1CCOC(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C26H27F2NO3/c27-23-12-11-21(15-24(23)28)25-17-29(13-14-31-25)16-22(30)18-32-26(19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-12,15,22,25-26,30H,13-14,16-18H2 |
| InChIKey | RSPASKUPBGPRCR-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |