C22H26ClF2NO3 — CID 138959090
1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride (PubChem CID 138959090) has the molecular formula C22H26ClF2NO3 and a molecular weight of 425.90 g/mol. Its IUPAC name is 1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride.
| Compound Name | 1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
|---|---|
| PubChem CID | 138959090 |
| Molecular Formula | C22H26ClF2NO3 |
| Molecular Weight | 425.90 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-[2-(3,4-difluorophenyl)morpholin-4-yl]-3-(2-prop-2-enylphenoxy)propan-2-ol;hydrochloride |
| SMILES | C=CCc1ccccc1OCC(O)CN1CCOC(c2ccc(F)c(F)c2)C1.Cl |
| InChI | InChI=1S/C22H25F2NO3.ClH/c1-2-5-16-6-3-4-7-21(16)28-15-18(26)13-25-10-11-27-22(14-25)17-8-9-19(23)20(24)12-17;/h2-4,6-9,12,18,22,26H,1,5,10-11,13-15H2;1H |
| InChIKey | BEWAEZAUGKKLGQ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.90 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|