C19H27F2NO3 — CID 138959087
1-cyclohexyloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol (PubChem CID 138959087) has the molecular formula C19H27F2NO3 and a molecular weight of 355.43 g/mol. Its IUPAC name is 1-cyclohexyloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol.
| Compound Name | 1-cyclohexyloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 138959087 |
| Molecular Formula | C19H27F2NO3 |
| Molecular Weight | 355.43 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | 1-cyclohexyloxy-3-[2-(3,4-difluorophenyl)morpholin-4-yl]propan-2-ol |
| SMILES | OC(COC1CCCCC1)CN1CCOC(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C19H27F2NO3/c20-17-7-6-14(10-18(17)21)19-12-22(8-9-24-19)11-15(23)13-25-16-4-2-1-3-5-16/h6-7,10,15-16,19,23H,1-5,8-9,11-13H2 |
| InChIKey | WYAWRAXVLWNLBZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |