C14H17F2NO3 — CID 95175743
methyl 3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propanoate (PubChem CID 95175743) has the molecular formula C14H17F2NO3 and a molecular weight of 285.29 g/mol. Its IUPAC name is methyl 3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propanoate.
| Compound Name | methyl 3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 95175743 |
| Molecular Formula | C14H17F2NO3 |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.12 |
| IUPAC Name | methyl 3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propanoate |
| SMILES | COC(=O)CCN1CCO[C@@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C14H17F2NO3/c1-19-14(18)4-5-17-6-7-20-13(9-17)10-2-3-11(15)12(16)8-10/h2-3,8,13H,4-7,9H2,1H3/t13-/m1/s1 |
| InChIKey | ZHRKRGPQWZENMX-CYBMUJFWSA-N |
| XLogP | 1.90 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |