C21H27NO4 — CID 56871644
methyl 5-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]pentanoate (PubChem CID 56871644) has the molecular formula C21H27NO4 and a molecular weight of 357.45 g/mol. Its IUPAC name is methyl 5-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]pentanoate.
| Compound Name | methyl 5-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]pentanoate |
|---|---|
| PubChem CID | 56871644 |
| Molecular Formula | C21H27NO4 |
| Molecular Weight | 357.45 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | methyl 5-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]pentanoate |
| SMILES | COC(=O)CCCCN1CCOC(c2ccc3cc(OC)ccc3c2)C1 |
| InChI | InChI=1S/C21H27NO4/c1-24-19-9-8-16-13-18(7-6-17(16)14-19)20-15-22(11-12-26-20)10-4-3-5-21(23)25-2/h6-9,13-14,20H,3-5,10-12,15H2,1-2H3 |
| InChIKey | TZCYKAYFUHHMBR-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.45 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|