C18H23ClN2O3 — CID 154892310
3-amino-1-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]propan-1-one;hydrochloride (PubChem CID 154892310) has the molecular formula C18H23ClN2O3 and a molecular weight of 350.85 g/mol. Its IUPAC name is 3-amino-1-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]propan-1-one;hydrochloride.
| Compound Name | 3-amino-1-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]propan-1-one;hydrochloride |
|---|---|
| PubChem CID | 154892310 |
| Molecular Formula | C18H23ClN2O3 |
| Molecular Weight | 350.85 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 3-amino-1-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]propan-1-one;hydrochloride |
| SMILES | COc1ccc2cc(C3CN(C(=O)CCN)CCO3)ccc2c1.Cl |
| InChI | InChI=1S/C18H22N2O3.ClH/c1-22-16-5-4-13-10-15(3-2-14(13)11-16)17-12-20(8-9-23-17)18(21)6-7-19;/h2-5,10-11,17H,6-9,12,19H2,1H3;1H |
| InChIKey | SBFYBECRVOCNRF-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.85 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |