C20H25ClN2O3 — CID 154924796
(1-aminocyclobutyl)-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone;hydrochloride (PubChem CID 154924796) has the molecular formula C20H25ClN2O3 and a molecular weight of 376.88 g/mol. Its IUPAC name is (1-aminocyclobutyl)-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone;hydrochloride.
| Compound Name | (1-aminocyclobutyl)-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone;hydrochloride |
|---|---|
| PubChem CID | 154924796 |
| Molecular Formula | C20H25ClN2O3 |
| Molecular Weight | 376.88 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | (1-aminocyclobutyl)-[2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]methanone;hydrochloride |
| SMILES | COc1ccc2cc(C3CN(C(=O)C4(N)CCC4)CCO3)ccc2c1.Cl |
| InChI | InChI=1S/C20H24N2O3.ClH/c1-24-17-6-5-14-11-16(4-3-15(14)12-17)18-13-22(9-10-25-18)19(23)20(21)7-2-8-20;/h3-6,11-12,18H,2,7-10,13,21H2,1H3;1H |
| InChIKey | PUCAQDAVMAWAPK-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 64.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.88 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |