C21H28N2O3 — CID 95455738
2-(diethylamino)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]ethanone (PubChem CID 95455738) has the molecular formula C21H28N2O3 and a molecular weight of 356.47 g/mol. Its IUPAC name is 2-(diethylamino)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]ethanone.
| Compound Name | 2-(diethylamino)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]ethanone |
|---|---|
| PubChem CID | 95455738 |
| Molecular Formula | C21H28N2O3 |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.21 |
| IUPAC Name | 2-(diethylamino)-1-[(2S)-2-(6-methoxynaphthalen-2-yl)morpholin-4-yl]ethanone |
| SMILES | CCN(CC)CC(=O)N1CCO[C@@H](c2ccc3cc(OC)ccc3c2)C1 |
| InChI | InChI=1S/C21H28N2O3/c1-4-22(5-2)15-21(24)23-10-11-26-20(14-23)18-7-6-17-13-19(25-3)9-8-16(17)12-18/h6-9,12-13,20H,4-5,10-11,14-15H2,1-3H3/t20-/m1/s1 |
| InChIKey | XOLXBVLZGTYMIS-HXUWFJFHSA-N |
| XLogP | 3.09 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |