C18H26F2N2O3 — CID 124889856
tert-butyl N-[3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propyl]carbamate (PubChem CID 124889856) has the molecular formula C18H26F2N2O3 and a molecular weight of 356.41 g/mol. Its IUPAC name is tert-butyl N-[3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propyl]carbamate |
|---|---|
| PubChem CID | 124889856 |
| Molecular Formula | C18H26F2N2O3 |
| Molecular Weight | 356.41 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | tert-butyl N-[3-[(2S)-2-(3,4-difluorophenyl)morpholin-4-yl]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCCN1CCO[C@@H](c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C18H26F2N2O3/c1-18(2,3)25-17(23)21-7-4-8-22-9-10-24-16(12-22)13-5-6-14(19)15(20)11-13/h5-6,11,16H,4,7-10,12H2,1-3H3,(H,21,23)/t16-/m1/s1 |
| InChIKey | KHEAUXZVCDHQEP-MRXNPFEDSA-N |
| XLogP | 3.25 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|