C26H43NO3 — CID 67033262
tert-butyl 4-[2-(4-octylphenyl)morpholin-4-yl]butanoate (PubChem CID 67033262) has the molecular formula C26H43NO3 and a molecular weight of 417.63 g/mol. Its IUPAC name is tert-butyl 4-[2-(4-octylphenyl)morpholin-4-yl]butanoate.
| Compound Name | tert-butyl 4-[2-(4-octylphenyl)morpholin-4-yl]butanoate |
|---|---|
| PubChem CID | 67033262 |
| Molecular Formula | C26H43NO3 |
| Molecular Weight | 417.63 g/mol |
| Exact Mass | 417.32 |
| IUPAC Name | tert-butyl 4-[2-(4-octylphenyl)morpholin-4-yl]butanoate |
| SMILES | CCCCCCCCc1ccc(C2CN(CCCC(=O)OC(C)(C)C)CCO2)cc1 |
| InChI | InChI=1S/C26H43NO3/c1-5-6-7-8-9-10-12-22-14-16-23(17-15-22)24-21-27(19-20-29-24)18-11-13-25(28)30-26(2,3)4/h14-17,24H,5-13,18-21H2,1-4H3 |
| InChIKey | RMXMSIFDDFGMJA-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.63 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|