C24H30ClNO4 — CID 67035803
tert-butyl 3-[2-[4-[(3-chlorophenyl)methoxy]phenyl]morpholin-4-yl]propanoate (PubChem CID 67035803) has the molecular formula C24H30ClNO4 and a molecular weight of 431.96 g/mol. Its IUPAC name is tert-butyl 3-[2-[4-[(3-chlorophenyl)methoxy]phenyl]morpholin-4-yl]propanoate.
| Compound Name | tert-butyl 3-[2-[4-[(3-chlorophenyl)methoxy]phenyl]morpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 67035803 |
| Molecular Formula | C24H30ClNO4 |
| Molecular Weight | 431.96 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | tert-butyl 3-[2-[4-[(3-chlorophenyl)methoxy]phenyl]morpholin-4-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1CCOC(c2ccc(OCc3cccc(Cl)c3)cc2)C1 |
| InChI | InChI=1S/C24H30ClNO4/c1-24(2,3)30-23(27)11-12-26-13-14-28-22(16-26)19-7-9-21(10-8-19)29-17-18-5-4-6-20(25)15-18/h4-10,15,22H,11-14,16-17H2,1-3H3 |
| InChIKey | JQYVKLFIPSEXBU-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.96 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |