C21H24ClNO4 — CID 67032360
3-[2-[4-[(2-chloro-4-methylphenyl)methoxy]phenyl]morpholin-4-yl]propanoic acid (PubChem CID 67032360) has the molecular formula C21H24ClNO4 and a molecular weight of 389.88 g/mol. Its IUPAC name is 3-[2-[4-[(2-chloro-4-methylphenyl)methoxy]phenyl]morpholin-4-yl]propanoic acid.
| Compound Name | 3-[2-[4-[(2-chloro-4-methylphenyl)methoxy]phenyl]morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 67032360 |
| Molecular Formula | C21H24ClNO4 |
| Molecular Weight | 389.88 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | 3-[2-[4-[(2-chloro-4-methylphenyl)methoxy]phenyl]morpholin-4-yl]propanoic acid |
| SMILES | Cc1ccc(COc2ccc(C3CN(CCC(=O)O)CCO3)cc2)c(Cl)c1 |
| InChI | InChI=1S/C21H24ClNO4/c1-15-2-3-17(19(22)12-15)14-27-18-6-4-16(5-7-18)20-13-23(10-11-26-20)9-8-21(24)25/h2-7,12,20H,8-11,13-14H2,1H3,(H,24,25) |
| InChIKey | DAOBYERMFWTMNQ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.88 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |