C19H22ClNO4 — CID 66654044
3-[2-(4-phenoxyphenyl)morpholin-4-yl]propanoic acid;hydrochloride (PubChem CID 66654044) has the molecular formula C19H22ClNO4 and a molecular weight of 363.84 g/mol. Its IUPAC name is 3-[2-(4-phenoxyphenyl)morpholin-4-yl]propanoic acid;hydrochloride.
| Compound Name | 3-[2-(4-phenoxyphenyl)morpholin-4-yl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66654044 |
| Molecular Formula | C19H22ClNO4 |
| Molecular Weight | 363.84 g/mol |
| Exact Mass | 363.12 |
| IUPAC Name | 3-[2-(4-phenoxyphenyl)morpholin-4-yl]propanoic acid;hydrochloride |
| SMILES | Cl.O=C(O)CCN1CCOC(c2ccc(Oc3ccccc3)cc2)C1 |
| InChI | InChI=1S/C19H21NO4.ClH/c21-19(22)10-11-20-12-13-23-18(14-20)15-6-8-17(9-7-15)24-16-4-2-1-3-5-16;/h1-9,18H,10-14H2,(H,21,22);1H |
| InChIKey | HGCBPEHSGCBQFH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.84 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |