C19H25NO4 — CID 51002386
3-[2-(4-hex-5-ynoxyphenyl)morpholin-4-yl]propanoic acid (PubChem CID 51002386) has the molecular formula C19H25NO4 and a molecular weight of 331.41 g/mol. Its IUPAC name is 3-[2-(4-hex-5-ynoxyphenyl)morpholin-4-yl]propanoic acid.
| Compound Name | 3-[2-(4-hex-5-ynoxyphenyl)morpholin-4-yl]propanoic acid |
|---|---|
| PubChem CID | 51002386 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | 3-[2-(4-hex-5-ynoxyphenyl)morpholin-4-yl]propanoic acid |
| SMILES | C#CCCCCOc1ccc(C2CN(CCC(=O)O)CCO2)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-2-3-4-5-13-23-17-8-6-16(7-9-17)18-15-20(12-14-24-18)11-10-19(21)22/h1,6-9,18H,3-5,10-15H2,(H,21,22) |
| InChIKey | MDBRWWNRXGFVNQ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|