C20H24ClNO5 — CID 66653995
3-[2-[4-(2-methoxyphenoxy)phenyl]morpholin-4-yl]propanoic acid;hydrochloride (PubChem CID 66653995) has the molecular formula C20H24ClNO5 and a molecular weight of 393.87 g/mol. Its IUPAC name is 3-[2-[4-(2-methoxyphenoxy)phenyl]morpholin-4-yl]propanoic acid;hydrochloride.
| Compound Name | 3-[2-[4-(2-methoxyphenoxy)phenyl]morpholin-4-yl]propanoic acid;hydrochloride |
|---|---|
| PubChem CID | 66653995 |
| Molecular Formula | C20H24ClNO5 |
| Molecular Weight | 393.87 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 3-[2-[4-(2-methoxyphenoxy)phenyl]morpholin-4-yl]propanoic acid;hydrochloride |
| SMILES | COc1ccccc1Oc1ccc(C2CN(CCC(=O)O)CCO2)cc1.Cl |
| InChI | InChI=1S/C20H23NO5.ClH/c1-24-17-4-2-3-5-18(17)26-16-8-6-15(7-9-16)19-14-21(12-13-25-19)11-10-20(22)23;/h2-9,19H,10-14H2,1H3,(H,22,23);1H |
| InChIKey | RABYEBJBZZXJFW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.87 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |