C27H28F3NO7 — CID 67032568
3-[2-[4-(2-naphthalen-2-yloxyethoxy)phenyl]morpholin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67032568) has the molecular formula C27H28F3NO7 and a molecular weight of 535.52 g/mol. Its IUPAC name is 3-[2-[4-(2-naphthalen-2-yloxyethoxy)phenyl]morpholin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[2-[4-(2-naphthalen-2-yloxyethoxy)phenyl]morpholin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67032568 |
| Molecular Formula | C27H28F3NO7 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | 3-[2-[4-(2-naphthalen-2-yloxyethoxy)phenyl]morpholin-4-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCN1CCOC(c2ccc(OCCOc3ccc4ccccc4c3)cc2)C1 |
| InChI | InChI=1S/C25H27NO5.C2HF3O2/c27-25(28)11-12-26-13-14-31-24(18-26)20-6-8-22(9-7-20)29-15-16-30-23-10-5-19-3-1-2-4-21(19)17-23;3-2(4,5)1(6)7/h1-10,17,24H,11-16,18H2,(H,27,28);(H,6,7) |
| InChIKey | DQLYNFMYKIILHO-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 105.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|