C22H22F3NO5 — CID 87243620
(2,2,2-trifluoroacetyl) 3-[2-(4-phenylmethoxyphenyl)morpholin-4-yl]propanoate (PubChem CID 87243620) has the molecular formula C22H22F3NO5 and a molecular weight of 437.41 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[2-(4-phenylmethoxyphenyl)morpholin-4-yl]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[2-(4-phenylmethoxyphenyl)morpholin-4-yl]propanoate |
|---|---|
| PubChem CID | 87243620 |
| Molecular Formula | C22H22F3NO5 |
| Molecular Weight | 437.41 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[2-(4-phenylmethoxyphenyl)morpholin-4-yl]propanoate |
| SMILES | O=C(CCN1CCOC(c2ccc(OCc3ccccc3)cc2)C1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C22H22F3NO5/c23-22(24,25)21(28)31-20(27)10-11-26-12-13-29-19(14-26)17-6-8-18(9-7-17)30-15-16-4-2-1-3-5-16/h1-9,19H,10-15H2 |
| InChIKey | CEIYNBQKFKLGDN-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.41 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|