C21H20Cl2F3NO3 — CID 142766039
3-[2-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoyl chloride (PubChem CID 142766039) has the molecular formula C21H20Cl2F3NO3 and a molecular weight of 462.30 g/mol. Its IUPAC name is 3-[2-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoyl chloride.
| Compound Name | 3-[2-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoyl chloride |
|---|---|
| PubChem CID | 142766039 |
| Molecular Formula | C21H20Cl2F3NO3 |
| Molecular Weight | 462.30 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 3-[2-[4-[[2-chloro-3-(trifluoromethyl)phenyl]methoxy]phenyl]morpholin-4-yl]propanoyl chloride |
| SMILES | O=C(Cl)CCN1CCOC(c2ccc(OCc3cccc(C(F)(F)F)c3Cl)cc2)C1 |
| InChI | InChI=1S/C21H20Cl2F3NO3/c22-19(28)8-9-27-10-11-29-18(12-27)14-4-6-16(7-5-14)30-13-15-2-1-3-17(20(15)23)21(24,25)26/h1-7,18H,8-13H2 |
| InChIKey | IQDURZSIKFXGKN-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.30 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|