C21H22Cl3NO4 — CID 142765936
3-[2-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]morpholin-4-yl]propanoyl chloride (PubChem CID 142765936) has the molecular formula C21H22Cl3NO4 and a molecular weight of 458.77 g/mol. Its IUPAC name is 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]morpholin-4-yl]propanoyl chloride.
| Compound Name | 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]morpholin-4-yl]propanoyl chloride |
|---|---|
| PubChem CID | 142765936 |
| Molecular Formula | C21H22Cl3NO4 |
| Molecular Weight | 458.77 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | 3-[2-[4-[(2,6-dichlorophenyl)methoxy]-3-methoxyphenyl]morpholin-4-yl]propanoyl chloride |
| SMILES | COc1cc(C2CN(CCC(=O)Cl)CCO2)ccc1OCc1c(Cl)cccc1Cl |
| InChI | InChI=1S/C21H22Cl3NO4/c1-27-19-11-14(20-12-25(9-10-28-20)8-7-21(24)26)5-6-18(19)29-13-15-16(22)3-2-4-17(15)23/h2-6,11,20H,7-10,12-13H2,1H3 |
| InChIKey | NVNDSYURFNREKX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.77 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|