C25H28F3NO4 — CID 87179774
(2,2,2-trifluoroacetyl) 3-[4-[4-(3-phenylpropoxy)phenyl]piperidin-1-yl]propanoate (PubChem CID 87179774) has the molecular formula C25H28F3NO4 and a molecular weight of 463.50 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) 3-[4-[4-(3-phenylpropoxy)phenyl]piperidin-1-yl]propanoate.
| Compound Name | (2,2,2-trifluoroacetyl) 3-[4-[4-(3-phenylpropoxy)phenyl]piperidin-1-yl]propanoate |
|---|---|
| PubChem CID | 87179774 |
| Molecular Formula | C25H28F3NO4 |
| Molecular Weight | 463.50 g/mol |
| Exact Mass | 463.20 |
| IUPAC Name | (2,2,2-trifluoroacetyl) 3-[4-[4-(3-phenylpropoxy)phenyl]piperidin-1-yl]propanoate |
| SMILES | O=C(CCN1CCC(c2ccc(OCCCc3ccccc3)cc2)CC1)OC(=O)C(F)(F)F |
| InChI | InChI=1S/C25H28F3NO4/c26-25(27,28)24(31)33-23(30)14-17-29-15-12-21(13-16-29)20-8-10-22(11-9-20)32-18-4-7-19-5-2-1-3-6-19/h1-3,5-6,8-11,21H,4,7,12-18H2 |
| InChIKey | PDGOEFDRAGXNPF-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|