About 4-phenyl-1-(2-phenylethyl)piperidine;propanamide
4-phenyl-1-(2-phenylethyl)piperidine;propanamide (PubChem CID 175431355) has the molecular formula C22H30N2O
and a molecular weight of 338.50 g/mol. Its IUPAC name is 4-phenyl-1-(2-phenylethyl)piperidine;propanamide.
Molecular Properties
| Compound Name | 4-phenyl-1-(2-phenylethyl)piperidine;propanamide |
| PubChem CID | 175431355 |
| Molecular Formula | C22H30N2O |
| Molecular Weight | 338.50 g/mol |
| Exact Mass | 338.24 |
| IUPAC Name | 4-phenyl-1-(2-phenylethyl)piperidine;propanamide |
| SMILES | CCC(N)=O.c1ccc(CCN2CCC(c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C19H23N.C3H7NO/c1-3-7-17(8-4-1)11-14-20-15-12-19(13-16-20)18-9-5-2-6-10-18;1-2-3(4)5/h1-10,19H,11-16H2;2H2,1H3,(H2,4,5) |
| InChIKey | SGGGVUDLZGGSFW-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.50 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-1-(2-phenylethyl)piperidine;propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-1-(2-phenylethyl)piperidine;propanamide?
The IUPAC name of 4-phenyl-1-(2-phenylethyl)piperidine;propanamide (CID 175431355) is 4-phenyl-1-(2-phenylethyl)piperidine;propanamide.
What is the SMILES notation for 4-phenyl-1-(2-phenylethyl)piperidine;propanamide?
The canonical SMILES for 4-phenyl-1-(2-phenylethyl)piperidine;propanamide is CCC(N)=O.c1ccc(CCN2CCC(c3ccccc3)CC2)cc1.
What is the InChIKey of 4-phenyl-1-(2-phenylethyl)piperidine;propanamide?
The InChIKey is SGGGVUDLZGGSFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H23N.C3H7NO/c1-3-7-17(8-4-1)11-14-20-15-12-19(13-16-20)18-9-5-2-6-10-18;1-2-3(4)5/h1-10,19H,11-16H2;2H2,1H3,(H2,4,5).
What are the key properties of 4-phenyl-1-(2-phenylethyl)piperidine;propanamide?
4-phenyl-1-(2-phenylethyl)piperidine;propanamide has a molecular weight of 338.50 g/mol, XLogP of 3.99, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-1-(2-phenylethyl)piperidine;propanamide is sourced from PubChem (CID 175431355), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).