C18H26N2O5 — CID 118877840
oxalic acid;N-[1-(2-phenylethyl)piperidin-4-yl]propanamide (PubChem CID 118877840) has the molecular formula C18H26N2O5 and a molecular weight of 350.41 g/mol. Its IUPAC name is oxalic acid;N-[1-(2-phenylethyl)piperidin-4-yl]propanamide.
| Compound Name | oxalic acid;N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 118877840 |
| Molecular Formula | C18H26N2O5 |
| Molecular Weight | 350.41 g/mol |
| Exact Mass | 350.18 |
| IUPAC Name | oxalic acid;N-[1-(2-phenylethyl)piperidin-4-yl]propanamide |
| SMILES | CCC(=O)NC1CCN(CCc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/C16H24N2O.C2H2O4/c1-2-16(19)17-15-9-12-18(13-10-15)11-8-14-6-4-3-5-7-14;3-1(4)2(5)6/h3-7,15H,2,8-13H2,1H3,(H,17,19);(H,3,4)(H,5,6) |
| InChIKey | AOKKVCVHCNNRNS-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.41 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|