C34H50N4O6 — CID 146470915
oxalic acid;bis(N-[1-(2-phenylethyl)piperidin-4-yl]propanamide) (PubChem CID 146470915) has the molecular formula C34H50N4O6 and a molecular weight of 610.80 g/mol. Its IUPAC name is oxalic acid;bis(N-[1-(2-phenylethyl)piperidin-4-yl]propanamide).
| Compound Name | oxalic acid;bis(N-[1-(2-phenylethyl)piperidin-4-yl]propanamide) |
|---|---|
| PubChem CID | 146470915 |
| Molecular Formula | C34H50N4O6 |
| Molecular Weight | 610.80 g/mol |
| Exact Mass | 610.37 |
| IUPAC Name | oxalic acid;bis(N-[1-(2-phenylethyl)piperidin-4-yl]propanamide) |
| SMILES | CCC(=O)NC1CCN(CCc2ccccc2)CC1.CCC(=O)NC1CCN(CCc2ccccc2)CC1.O=C(O)C(=O)O |
| InChI | InChI=1S/2C16H24N2O.C2H2O4/c2*1-2-16(19)17-15-9-12-18(13-10-15)11-8-14-6-4-3-5-7-14;3-1(4)2(5)6/h2*3-7,15H,2,8-13H2,1H3,(H,17,19);(H,3,4)(H,5,6) |
| InChIKey | DWSIFAPFMGHLJE-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 139.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.80 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|