C25H28F3NO5 — CID 66853822
3-[4-[4-(3-phenylpropoxy)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 66853822) has the molecular formula C25H28F3NO5 and a molecular weight of 479.50 g/mol. Its IUPAC name is 3-[4-[4-(3-phenylpropoxy)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[4-[4-(3-phenylpropoxy)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 66853822 |
| Molecular Formula | C25H28F3NO5 |
| Molecular Weight | 479.50 g/mol |
| Exact Mass | 479.19 |
| IUPAC Name | 3-[4-[4-(3-phenylpropoxy)phenyl]-3,6-dihydro-2H-pyridin-1-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCN1CC=C(c2ccc(OCCCc3ccccc3)cc2)CC1 |
| InChI | InChI=1S/C23H27NO3.C2HF3O2/c25-23(26)14-17-24-15-12-21(13-16-24)20-8-10-22(11-9-20)27-18-4-7-19-5-2-1-3-6-19;3-2(4,5)1(6)7/h1-3,5-6,8-12H,4,7,13-18H2,(H,25,26);(H,6,7) |
| InChIKey | IVKFDGNXNNWHPD-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.50 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|