C26H32F3NO5 — CID 67199319
3-[7-(5-phenylpentoxy)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]propanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 67199319) has the molecular formula C26H32F3NO5 and a molecular weight of 495.54 g/mol. Its IUPAC name is 3-[7-(5-phenylpentoxy)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]propanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[7-(5-phenylpentoxy)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]propanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67199319 |
| Molecular Formula | C26H32F3NO5 |
| Molecular Weight | 495.54 g/mol |
| Exact Mass | 495.22 |
| IUPAC Name | 3-[7-(5-phenylpentoxy)-1,3,4,5-tetrahydro-2-benzazepin-2-yl]propanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.O=C(O)CCN1CCCc2cc(OCCCCCc3ccccc3)ccc2C1 |
| InChI | InChI=1S/C24H31NO3.C2HF3O2/c26-24(27)14-16-25-15-7-11-21-18-23(13-12-22(21)19-25)28-17-6-2-5-10-20-8-3-1-4-9-20;3-2(4,5)1(6)7/h1,3-4,8-9,12-13,18H,2,5-7,10-11,14-17,19H2,(H,26,27);(H,6,7) |
| InChIKey | IRRZIGUGZCVKRP-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.54 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|