C24H29ClF3NO — CID 70077325
1-[2-(4-butoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine;hydrochloride (PubChem CID 70077325) has the molecular formula C24H29ClF3NO and a molecular weight of 439.95 g/mol. Its IUPAC name is 1-[2-(4-butoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine;hydrochloride.
| Compound Name | 1-[2-(4-butoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine;hydrochloride |
|---|---|
| PubChem CID | 70077325 |
| Molecular Formula | C24H29ClF3NO |
| Molecular Weight | 439.95 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[2-(4-butoxyphenyl)ethyl]-4-[3-(trifluoromethyl)phenyl]-3,6-dihydro-2H-pyridine;hydrochloride |
| SMILES | CCCCOc1ccc(CCN2CC=C(c3cccc(C(F)(F)F)c3)CC2)cc1.Cl |
| InChI | InChI=1S/C24H28F3NO.ClH/c1-2-3-17-29-23-9-7-19(8-10-23)11-14-28-15-12-20(13-16-28)21-5-4-6-22(18-21)24(25,26)27;/h4-10,12,18H,2-3,11,13-17H2,1H3;1H |
| InChIKey | YVERLOKXWXMAMM-UHFFFAOYSA-N |
| XLogP | 6.64 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.95 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|