C33H48N4O9 — CID 170966340
1-methyl-4-[3-(4-methylphenoxy)propyl]benzene;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 170966340) has the molecular formula C33H48N4O9 and a molecular weight of 644.77 g/mol. Its IUPAC name is 1-methyl-4-[3-(4-methylphenoxy)propyl]benzene;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 1-methyl-4-[3-(4-methylphenoxy)propyl]benzene;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 170966340 |
| Molecular Formula | C33H48N4O9 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.34 |
| IUPAC Name | 1-methyl-4-[3-(4-methylphenoxy)propyl]benzene;2-[4,7,10-tris(carboxymethyl)-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | Cc1ccc(CCCOc2ccc(C)cc2)cc1.O=C(O)CN1CCN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC1 |
| InChI | InChI=1S/C17H20O.C16H28N4O8/c1-14-5-9-16(10-6-14)4-3-13-18-17-11-7-15(2)8-12-17;21-13(22)9-17-1-2-18(10-14(23)24)5-6-20(12-16(27)28)8-7-19(4-3-17)11-15(25)26/h5-12H,3-4,13H2,1-2H3;1-12H2,(H,21,22)(H,23,24)(H,25,26)(H,27,28) |
| InChIKey | OCWIUDWQYQLAMK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 171.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|