C28H46N4O8 — CID 170966263
ethane;2-[4,7,10-tris(carboxymethyl)-6-[3-(4-methylphenyl)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 170966263) has the molecular formula C28H46N4O8 and a molecular weight of 566.70 g/mol. Its IUPAC name is ethane;2-[4,7,10-tris(carboxymethyl)-6-[3-(4-methylphenyl)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | ethane;2-[4,7,10-tris(carboxymethyl)-6-[3-(4-methylphenyl)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 170966263 |
| Molecular Formula | C28H46N4O8 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.33 |
| IUPAC Name | ethane;2-[4,7,10-tris(carboxymethyl)-6-[3-(4-methylphenyl)propyl]-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CC.Cc1ccc(CCCC2CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CCN2CC(=O)O)cc1 |
| InChI | InChI=1S/C26H40N4O8.C2H6/c1-20-5-7-21(8-6-20)3-2-4-22-15-29(18-25(35)36)12-11-27(16-23(31)32)9-10-28(17-24(33)34)13-14-30(22)19-26(37)38;1-2/h5-8,22H,2-4,9-19H2,1H3,(H,31,32)(H,33,34)(H,35,36)(H,37,38);1-2H3 |
| InChIKey | QMHDZBTWTFURLK-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 162.16 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |