C23H37N5O6 — CID 59079179
2-[6-[(4-aminophenyl)methyl]-4,7-bis(carboxymethyl)-10-ethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid (PubChem CID 59079179) has the molecular formula C23H37N5O6 and a molecular weight of 479.58 g/mol. Its IUPAC name is 2-[6-[(4-aminophenyl)methyl]-4,7-bis(carboxymethyl)-10-ethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid.
| Compound Name | 2-[6-[(4-aminophenyl)methyl]-4,7-bis(carboxymethyl)-10-ethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
|---|---|
| PubChem CID | 59079179 |
| Molecular Formula | C23H37N5O6 |
| Molecular Weight | 479.58 g/mol |
| Exact Mass | 479.27 |
| IUPAC Name | 2-[6-[(4-aminophenyl)methyl]-4,7-bis(carboxymethyl)-10-ethyl-1,4,7,10-tetrazacyclododec-1-yl]acetic acid |
| SMILES | CCN1CCN(CC(=O)O)CCN(CC(=O)O)CC(Cc2ccc(N)cc2)N(CC(=O)O)CC1 |
| InChI | InChI=1S/C23H37N5O6/c1-2-25-7-8-26(15-21(29)30)9-10-27(16-22(31)32)14-20(28(12-11-25)17-23(33)34)13-18-3-5-19(24)6-4-18/h3-6,20H,2,7-17,24H2,1H3,(H,29,30)(H,31,32)(H,33,34) |
| InChIKey | XRPDVMAVIYNALC-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 150.88 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.58 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|